C40H54N4O5S — CID 155084832
2-[[(5-tert-butylthiophen-2-yl)-hydroxymethyl]amino]-N-(5,5-dihydroxypentyl)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanamide (PubChem CID 155084832) has the molecular formula C40H54N4O5S and a molecular weight of 702.96 g/mol. Its IUPAC name is 2-[[(5-tert-butylthiophen-2-yl)-hydroxymethyl]amino]-N-(5,5-dihydroxypentyl)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanamide.
| Compound Name | 2-[[(5-tert-butylthiophen-2-yl)-hydroxymethyl]amino]-N-(5,5-dihydroxypentyl)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 155084832 |
| Molecular Formula | C40H54N4O5S |
| Molecular Weight | 702.96 g/mol |
| Exact Mass | 702.38 |
| IUPAC Name | 2-[[(5-tert-butylthiophen-2-yl)-hydroxymethyl]amino]-N-(5,5-dihydroxypentyl)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanamide |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(O)c4ccc(C(C)(C)C)s4)C(=O)NCCCCC(O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C40H54N4O5S/c1-5-6-7-8-11-24-49-32-19-17-29(18-20-32)31-26-42-37(43-27-31)30-15-13-28(14-16-30)25-33(38(47)41-23-10-9-12-36(45)46)44-39(48)34-21-22-35(50-34)40(2,3)4/h13-22,26-27,33,36,39,44-46,48H,5-12,23-25H2,1-4H3,(H,41,47) |
| InChIKey | ZQHOLAZIOFARDT-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 136.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.96 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|