C39H47N3O4 — CID 123363934
4-tert-butyl-N-[1-[4-[5-(4-heptoxyphenyl)-4-methoxypyrimidin-2-yl]phenyl]-3-oxobutan-2-yl]benzamide (PubChem CID 123363934) has the molecular formula C39H47N3O4 and a molecular weight of 621.82 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-[4-[5-(4-heptoxyphenyl)-4-methoxypyrimidin-2-yl]phenyl]-3-oxobutan-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[1-[4-[5-(4-heptoxyphenyl)-4-methoxypyrimidin-2-yl]phenyl]-3-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 123363934 |
| Molecular Formula | C39H47N3O4 |
| Molecular Weight | 621.82 g/mol |
| Exact Mass | 621.36 |
| IUPAC Name | 4-tert-butyl-N-[1-[4-[5-(4-heptoxyphenyl)-4-methoxypyrimidin-2-yl]phenyl]-3-oxobutan-2-yl]benzamide |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4ccc(C(C)(C)C)cc4)C(C)=O)cc3)nc2OC)cc1 |
| InChI | InChI=1S/C39H47N3O4/c1-7-8-9-10-11-24-46-33-22-18-29(19-23-33)34-26-40-36(42-38(34)45-6)30-14-12-28(13-15-30)25-35(27(2)43)41-37(44)31-16-20-32(21-17-31)39(3,4)5/h12-23,26,35H,7-11,24-25H2,1-6H3,(H,41,44) |
| InChIKey | VQVPOOVCMLZAAU-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.82 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|