C17H26ClN2O3P — CID 144766665
methanamine;naphthalen-1-ol;propyl 2-(chlorophosphanylamino)propanoate (PubChem CID 144766665) has the molecular formula C17H26ClN2O3P and a molecular weight of 372.83 g/mol. Its IUPAC name is methanamine;naphthalen-1-ol;propyl 2-(chlorophosphanylamino)propanoate.
| Compound Name | methanamine;naphthalen-1-ol;propyl 2-(chlorophosphanylamino)propanoate |
|---|---|
| PubChem CID | 144766665 |
| Molecular Formula | C17H26ClN2O3P |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | methanamine;naphthalen-1-ol;propyl 2-(chlorophosphanylamino)propanoate |
| SMILES | CCCOC(=O)C(C)NPCl.CN.Oc1cccc2ccccc12 |
| InChI | InChI=1S/C10H8O.C6H13ClNO2P.CH5N/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-3-4-10-6(9)5(2)8-11-7;1-2/h1-7,11H;5,8,11H,3-4H2,1-2H3;2H2,1H3 |
| InChIKey | NDXVUSKSSRZZAH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|