About methanamine;naphthalen-1-ol;propyl 2-(chlorophosphanylamino)propanoate
methanamine;naphthalen-1-ol;propyl 2-(chlorophosphanylamino)propanoate (PubChem CID 144766665) has the molecular formula C17H26ClN2O3P
and a molecular weight of 372.83 g/mol. Its IUPAC name is methanamine;naphthalen-1-ol;propyl 2-(chlorophosphanylamino)propanoate.
Molecular Properties
| Compound Name | methanamine;naphthalen-1-ol;propyl 2-(chlorophosphanylamino)propanoate |
| PubChem CID | 144766665 |
| Molecular Formula | C17H26ClN2O3P |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | methanamine;naphthalen-1-ol;propyl 2-(chlorophosphanylamino)propanoate |
| SMILES | CCCOC(=O)C(C)NPCl.CN.Oc1cccc2ccccc12 |
| InChI | InChI=1S/C10H8O.C6H13ClNO2P.CH5N/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-3-4-10-6(9)5(2)8-11-7;1-2/h1-7,11H;5,8,11H,3-4H2,1-2H3;2H2,1H3 |
| InChIKey | NDXVUSKSSRZZAH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methanamine;naphthalen-1-ol;propyl 2-(chlorophosphanylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;naphthalen-1-ol;propyl 2-(chlorophosphanylamino)propanoate?
The IUPAC name of methanamine;naphthalen-1-ol;propyl 2-(chlorophosphanylamino)propanoate (CID 144766665) is methanamine;naphthalen-1-ol;propyl 2-(chlorophosphanylamino)propanoate.
What is the SMILES notation for methanamine;naphthalen-1-ol;propyl 2-(chlorophosphanylamino)propanoate?
The canonical SMILES for methanamine;naphthalen-1-ol;propyl 2-(chlorophosphanylamino)propanoate is CCCOC(=O)C(C)NPCl.CN.Oc1cccc2ccccc12.
What is the InChIKey of methanamine;naphthalen-1-ol;propyl 2-(chlorophosphanylamino)propanoate?
The InChIKey is NDXVUSKSSRZZAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.C6H13ClNO2P.CH5N/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-3-4-10-6(9)5(2)8-11-7;1-2/h1-7,11H;5,8,11H,3-4H2,1-2H3;2H2,1H3.
What are the key properties of methanamine;naphthalen-1-ol;propyl 2-(chlorophosphanylamino)propanoate?
methanamine;naphthalen-1-ol;propyl 2-(chlorophosphanylamino)propanoate has a molecular weight of 372.83 g/mol, XLogP of 3.79, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;naphthalen-1-ol;propyl 2-(chlorophosphanylamino)propanoate is sourced from PubChem (CID 144766665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).