C10H16IN5O3 — CID 144766943
2-(iodoamino)-9-methyl-1H-purin-6-one;2-methoxypropan-1-ol (PubChem CID 144766943) has the molecular formula C10H16IN5O3 and a molecular weight of 381.17 g/mol. Its IUPAC name is 2-(iodoamino)-9-methyl-1H-purin-6-one;2-methoxypropan-1-ol.
| Compound Name | 2-(iodoamino)-9-methyl-1H-purin-6-one;2-methoxypropan-1-ol |
|---|---|
| PubChem CID | 144766943 |
| Molecular Formula | C10H16IN5O3 |
| Molecular Weight | 381.17 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 2-(iodoamino)-9-methyl-1H-purin-6-one;2-methoxypropan-1-ol |
| SMILES | COC(C)CO.Cn1cnc2c(=O)[nH]c(NI)nc21 |
| InChI | InChI=1S/C6H6IN5O.C4H10O2/c1-12-2-8-3-4(12)9-6(11-7)10-5(3)13;1-4(3-5)6-2/h2H,1H3,(H2,9,10,11,13);4-5H,3H2,1-2H3 |
| InChIKey | KUUIHJUMHXSLRM-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.17 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|