C22H22F2N2 — CID 144775844
(2E)-3-[3-(1,1-difluoroethyl)-5-(4-methylphenyl)phenyl]-4-methyl-2-(methylamino)penta-2,4-dienenitrile (PubChem CID 144775844) has the molecular formula C22H22F2N2 and a molecular weight of 352.43 g/mol. Its IUPAC name is (2E)-3-[3-(1,1-difluoroethyl)-5-(4-methylphenyl)phenyl]-4-methyl-2-(methylamino)penta-2,4-dienenitrile.
| Compound Name | (2E)-3-[3-(1,1-difluoroethyl)-5-(4-methylphenyl)phenyl]-4-methyl-2-(methylamino)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 144775844 |
| Molecular Formula | C22H22F2N2 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (2E)-3-[3-(1,1-difluoroethyl)-5-(4-methylphenyl)phenyl]-4-methyl-2-(methylamino)penta-2,4-dienenitrile |
| SMILES | C=C(C)/C(=C(/C#N)NC)c1cc(-c2ccc(C)cc2)cc(C(C)(F)F)c1 |
| InChI | InChI=1S/C22H22F2N2/c1-14(2)21(20(13-25)26-5)18-10-17(11-19(12-18)22(4,23)24)16-8-6-15(3)7-9-16/h6-12,26H,1H2,2-5H3/b21-20+ |
| InChIKey | PONNHSBHTDWRBA-QZQOTICOSA-N |
| XLogP | 5.80 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|