C21H34 — CID 144776425
ethane;(3E,5E,7E,9E)-7-ethenyl-3,6,10,11,11-pentamethyldodeca-1,3,5,7,9-pentaene (PubChem CID 144776425) has the molecular formula C21H34 and a molecular weight of 286.50 g/mol. Its IUPAC name is ethane;(3E,5E,7E,9E)-7-ethenyl-3,6,10,11,11-pentamethyldodeca-1,3,5,7,9-pentaene.
| Compound Name | ethane;(3E,5E,7E,9E)-7-ethenyl-3,6,10,11,11-pentamethyldodeca-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 144776425 |
| Molecular Formula | C21H34 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | ethane;(3E,5E,7E,9E)-7-ethenyl-3,6,10,11,11-pentamethyldodeca-1,3,5,7,9-pentaene |
| SMILES | C=C/C(C)=C/C=C(C)/C(C=C)=C/C=C(\C)C(C)(C)C.CC |
| InChI | InChI=1S/C19H28.C2H6/c1-9-15(3)11-12-16(4)18(10-2)14-13-17(5)19(6,7)8;1-2/h9-14H,1-2H2,3-8H3;1-2H3/b15-11+,16-12+,17-13+,18-14+; |
| InChIKey | HUYIWOGKSUDGIT-CPXXYRAZSA-N |
| XLogP | 7.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|