C18H15NO4 — CID 144777394
4-(4-anilinophenyl)benzene-1,2,3,5-tetrol (PubChem CID 144777394) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is 4-(4-anilinophenyl)benzene-1,2,3,5-tetrol.
| Compound Name | 4-(4-anilinophenyl)benzene-1,2,3,5-tetrol |
|---|---|
| PubChem CID | 144777394 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 4-(4-anilinophenyl)benzene-1,2,3,5-tetrol |
| SMILES | Oc1cc(O)c(-c2ccc(Nc3ccccc3)cc2)c(O)c1O |
| InChI | InChI=1S/C18H15NO4/c20-14-10-15(21)17(22)18(23)16(14)11-6-8-13(9-7-11)19-12-4-2-1-3-5-12/h1-10,19-23H |
| InChIKey | JOPBIIIDURNVKX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|