C29H22N6O12S3 — CID 144827022
6-amino-4-hydroxy-3-[2-[4-[(2-methyl-1,3-dioxoisoindol-5-yl)diazenyl]-7-sulfonaphthalen-1-yl]hydrazinyl]naphthalene-2,7-disulfonic acid (PubChem CID 144827022) has the molecular formula C29H22N6O12S3 and a molecular weight of 742.73 g/mol. Its IUPAC name is 6-amino-4-hydroxy-3-[2-[4-[(2-methyl-1,3-dioxoisoindol-5-yl)diazenyl]-7-sulfonaphthalen-1-yl]hydrazinyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 6-amino-4-hydroxy-3-[2-[4-[(2-methyl-1,3-dioxoisoindol-5-yl)diazenyl]-7-sulfonaphthalen-1-yl]hydrazinyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 144827022 |
| Molecular Formula | C29H22N6O12S3 |
| Molecular Weight | 742.73 g/mol |
| Exact Mass | 742.05 |
| IUPAC Name | 6-amino-4-hydroxy-3-[2-[4-[(2-methyl-1,3-dioxoisoindol-5-yl)diazenyl]-7-sulfonaphthalen-1-yl]hydrazinyl]naphthalene-2,7-disulfonic acid |
| SMILES | CN1C(=O)c2ccc(/N=N/c3ccc(NNc4c(S(=O)(=O)O)cc5cc(S(=O)(=O)O)c(N)cc5c4O)c4cc(S(=O)(=O)O)ccc34)cc2C1=O |
| InChI | InChI=1S/C29H22N6O12S3/c1-35-28(37)17-4-2-14(10-20(17)29(35)38)31-32-22-6-7-23(19-11-15(48(39,40)41)3-5-16(19)22)33-34-26-25(50(45,46)47)9-13-8-24(49(42,43)44)21(30)12-18(13)27(26)36/h2-12,33-34,36H,30H2,1H3,(H,39,40,41)(H,42,43,44)(H,45,46,47)/b32-31+ |
| InChIKey | NDWFCLVAOCMQGC-QNEJGDQOSA-N |
| XLogP | 4.10 |
| TPSA | 295.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.73 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|