C20H23F3N4O — CID 144839061
1-[2-[(E)-2-(2-cyclopropylphenyl)ethenyl]-3-(trifluoromethyl)phenyl]-1-methylhydrazine;formohydrazide (PubChem CID 144839061) has the molecular formula C20H23F3N4O and a molecular weight of 392.43 g/mol. Its IUPAC name is 1-[2-[(E)-2-(2-cyclopropylphenyl)ethenyl]-3-(trifluoromethyl)phenyl]-1-methylhydrazine;formohydrazide.
| Compound Name | 1-[2-[(E)-2-(2-cyclopropylphenyl)ethenyl]-3-(trifluoromethyl)phenyl]-1-methylhydrazine;formohydrazide |
|---|---|
| PubChem CID | 144839061 |
| Molecular Formula | C20H23F3N4O |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 1-[2-[(E)-2-(2-cyclopropylphenyl)ethenyl]-3-(trifluoromethyl)phenyl]-1-methylhydrazine;formohydrazide |
| SMILES | CN(N)c1cccc(C(F)(F)F)c1/C=C/c1ccccc1C1CC1.NNC=O |
| InChI | InChI=1S/C19H19F3N2.CH4N2O/c1-24(23)18-8-4-7-17(19(20,21)22)16(18)12-11-13-5-2-3-6-15(13)14-9-10-14;2-3-1-4/h2-8,11-12,14H,9-10,23H2,1H3;1H,2H2,(H,3,4)/b12-11+; |
| InChIKey | QAISWYLCEVSBDK-CALJPSDSSA-N |
| XLogP | 3.67 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|