C23H28N4S — CID 144859868
4-[2-[3-[2-[[(2R)-2-phenylpropyl]amino]ethyl]anilino]prop-2-enyl]-1,3-thiazol-2-amine (PubChem CID 144859868) has the molecular formula C23H28N4S and a molecular weight of 392.57 g/mol. Its IUPAC name is 4-[2-[3-[2-[[(2R)-2-phenylpropyl]amino]ethyl]anilino]prop-2-enyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[2-[3-[2-[[(2R)-2-phenylpropyl]amino]ethyl]anilino]prop-2-enyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 144859868 |
| Molecular Formula | C23H28N4S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 4-[2-[3-[2-[[(2R)-2-phenylpropyl]amino]ethyl]anilino]prop-2-enyl]-1,3-thiazol-2-amine |
| SMILES | C=C(Cc1csc(N)n1)Nc1cccc(CCNC[C@H](C)c2ccccc2)c1 |
| InChI | InChI=1S/C23H28N4S/c1-17(20-8-4-3-5-9-20)15-25-12-11-19-7-6-10-21(14-19)26-18(2)13-22-16-28-23(24)27-22/h3-10,14,16-17,25-26H,2,11-13,15H2,1H3,(H2,24,27)/t17-/m0/s1 |
| InChIKey | RRHCZBIJFGOCQR-KRWDZBQOSA-N |
| XLogP | 4.83 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|