C36H24N6 — CID 144876319
18-[3-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6,9,18-triazapentacyclo[13.2.1.05,17.06,10.011,16]octadeca-1,3,5(17),7,9,11(16),12,14-octaene (PubChem CID 144876319) has the molecular formula C36H24N6 and a molecular weight of 540.63 g/mol. Its IUPAC name is 18-[3-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6,9,18-triazapentacyclo[13.2.1.05,17.06,10.011,16]octadeca-1,3,5(17),7,9,11(16),12,14-octaene.
| Compound Name | 18-[3-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6,9,18-triazapentacyclo[13.2.1.05,17.06,10.011,16]octadeca-1,3,5(17),7,9,11(16),12,14-octaene |
|---|---|
| PubChem CID | 144876319 |
| Molecular Formula | C36H24N6 |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 18-[3-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6,9,18-triazapentacyclo[13.2.1.05,17.06,10.011,16]octadeca-1,3,5(17),7,9,11(16),12,14-octaene |
| SMILES | C=C/C=C(\C=C)c1nc(-c2ccccc2)nc(-c2cccc(-n3c4cccc5c4c4c3cccc4n3ccnc53)c2)n1 |
| InChI | InChI=1S/C36H24N6/c1-3-11-23(4-2)33-38-34(24-12-6-5-7-13-24)40-35(39-33)25-14-8-15-26(22-25)42-29-18-9-16-27-31(29)32-28(17-10-19-30(32)42)41-21-20-37-36(27)41/h3-22H,1-2H2/b23-11+ |
| InChIKey | NXRHYDKMXZVWDS-FOKLQQMPSA-N |
| XLogP | 8.30 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|