C19H23N — CID 144876387
(2Z,5Z)-5-[(Z)-but-2-en-2-yl]-2-methyl-1-phenylocta-2,5,7-trien-1-imine (PubChem CID 144876387) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is (2Z,5Z)-5-[(Z)-but-2-en-2-yl]-2-methyl-1-phenylocta-2,5,7-trien-1-imine.
| Compound Name | (2Z,5Z)-5-[(Z)-but-2-en-2-yl]-2-methyl-1-phenylocta-2,5,7-trien-1-imine |
|---|---|
| PubChem CID | 144876387 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | (2Z,5Z)-5-[(Z)-but-2-en-2-yl]-2-methyl-1-phenylocta-2,5,7-trien-1-imine |
| SMILES | [H]/N=C(C(\C)=C/CC(=C/C=C)/C(C)=C\C)/c1ccccc1 |
| InChI | InChI=1S/C19H23N/c1-5-10-17(15(3)6-2)14-13-16(4)19(20)18-11-8-7-9-12-18/h5-13,20H,1,14H2,2-4H3/b15-6-,16-13-,17-10-,20-19+ |
| InChIKey | HWFKKHZDHCMUQP-PJQRLZKDSA-N |
| XLogP | 5.47 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|