C8H14N2 — CID 144895354
(3S,5R)-3-ethynyl-1,5-dimethylpiperazine (PubChem CID 144895354) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (3S,5R)-3-ethynyl-1,5-dimethylpiperazine.
| Compound Name | (3S,5R)-3-ethynyl-1,5-dimethylpiperazine |
|---|---|
| PubChem CID | 144895354 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (3S,5R)-3-ethynyl-1,5-dimethylpiperazine |
| SMILES | C#C[C@H]1CN(C)C[C@@H](C)N1 |
| InChI | InChI=1S/C8H14N2/c1-4-8-6-10(3)5-7(2)9-8/h1,7-9H,5-6H2,2-3H3/t7-,8+/m1/s1 |
| InChIKey | RWLLKQLZKCLGOP-SFYZADRCSA-N |
| XLogP | -0.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|