About (3S,5R)-3-ethynyl-1,5-dimethylpiperazine
(3S,5R)-3-ethynyl-1,5-dimethylpiperazine (PubChem CID 144895354) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is (3S,5R)-3-ethynyl-1,5-dimethylpiperazine.
Molecular Properties
| Compound Name | (3S,5R)-3-ethynyl-1,5-dimethylpiperazine |
| PubChem CID | 144895354 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (3S,5R)-3-ethynyl-1,5-dimethylpiperazine |
| SMILES | C#C[C@H]1CN(C)C[C@@H](C)N1 |
| InChI | InChI=1S/C8H14N2/c1-4-8-6-10(3)5-7(2)9-8/h1,7-9H,5-6H2,2-3H3/t7-,8+/m1/s1 |
| InChIKey | RWLLKQLZKCLGOP-SFYZADRCSA-N |
| XLogP | -0.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S,5R)-3-ethynyl-1,5-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5R)-3-ethynyl-1,5-dimethylpiperazine?
The IUPAC name of (3S,5R)-3-ethynyl-1,5-dimethylpiperazine (CID 144895354) is (3S,5R)-3-ethynyl-1,5-dimethylpiperazine.
What is the SMILES notation for (3S,5R)-3-ethynyl-1,5-dimethylpiperazine?
The canonical SMILES for (3S,5R)-3-ethynyl-1,5-dimethylpiperazine is C#C[C@H]1CN(C)C[C@@H](C)N1.
What is the InChIKey of (3S,5R)-3-ethynyl-1,5-dimethylpiperazine?
The InChIKey is RWLLKQLZKCLGOP-SFYZADRCSA-N. The full InChI is InChI=1S/C8H14N2/c1-4-8-6-10(3)5-7(2)9-8/h1,7-9H,5-6H2,2-3H3/t7-,8+/m1/s1.
What are the key properties of (3S,5R)-3-ethynyl-1,5-dimethylpiperazine?
(3S,5R)-3-ethynyl-1,5-dimethylpiperazine has a molecular weight of 138.21 g/mol, XLogP of -0.09, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5R)-3-ethynyl-1,5-dimethylpiperazine is sourced from PubChem (CID 144895354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).