C11H14O3 — CID 144931318
(2Z)-3-(1,3-dioxolan-2-yl)-2-[(Z)-prop-1-enyl]penta-2,4-dienal (PubChem CID 144931318) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is (2Z)-3-(1,3-dioxolan-2-yl)-2-[(Z)-prop-1-enyl]penta-2,4-dienal.
| Compound Name | (2Z)-3-(1,3-dioxolan-2-yl)-2-[(Z)-prop-1-enyl]penta-2,4-dienal |
|---|---|
| PubChem CID | 144931318 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (2Z)-3-(1,3-dioxolan-2-yl)-2-[(Z)-prop-1-enyl]penta-2,4-dienal |
| SMILES | C=C/C(=C(C=O)\C=C/C)C1OCCO1 |
| InChI | InChI=1S/C11H14O3/c1-3-5-9(8-12)10(4-2)11-13-6-7-14-11/h3-5,8,11H,2,6-7H2,1H3/b5-3-,10-9- |
| InChIKey | FEMQQFLOCPIGAR-AZOIALCZSA-N |
| XLogP | 1.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|