C23H33N3O2 — CID 144950632
N-[1-(5-acetyl-2-pyridinyl)ethylidene]-N'-methylmethanimidamide;(2E,4Z)-6-methylidene-2-propan-2-yloxyocta-2,4-diene (PubChem CID 144950632) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is N-[1-(5-acetyl-2-pyridinyl)ethylidene]-N'-methylmethanimidamide;(2E,4Z)-6-methylidene-2-propan-2-yloxyocta-2,4-diene.
| Compound Name | N-[1-(5-acetyl-2-pyridinyl)ethylidene]-N'-methylmethanimidamide;(2E,4Z)-6-methylidene-2-propan-2-yloxyocta-2,4-diene |
|---|---|
| PubChem CID | 144950632 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | N-[1-(5-acetyl-2-pyridinyl)ethylidene]-N'-methylmethanimidamide;(2E,4Z)-6-methylidene-2-propan-2-yloxyocta-2,4-diene |
| SMILES | C/N=C/N=C(\C)c1ccc(C(C)=O)cn1.C=C(/C=C\C=C(/C)OC(C)C)CC |
| InChI | InChI=1S/C12H20O.C11H13N3O/c1-6-11(4)8-7-9-12(5)13-10(2)3;1-8(14-7-12-3)11-5-4-10(6-13-11)9(2)15/h7-10H,4,6H2,1-3,5H3;4-7H,1-3H3/b8-7-,12-9+;12-7+,14-8+ |
| InChIKey | OMUQXULEMVZJQA-SHWSGUNRSA-N |
| XLogP | 5.59 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|