C15H16F2O2 — CID 144962104
(3S)-3-[(E)-4-(3,4-difluorophenyl)-3-hydroxybut-1-enyl]cyclopentan-1-one (PubChem CID 144962104) has the molecular formula C15H16F2O2 and a molecular weight of 266.29 g/mol. Its IUPAC name is (3S)-3-[(E)-4-(3,4-difluorophenyl)-3-hydroxybut-1-enyl]cyclopentan-1-one.
| Compound Name | (3S)-3-[(E)-4-(3,4-difluorophenyl)-3-hydroxybut-1-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 144962104 |
| Molecular Formula | C15H16F2O2 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (3S)-3-[(E)-4-(3,4-difluorophenyl)-3-hydroxybut-1-enyl]cyclopentan-1-one |
| SMILES | O=C1CC[C@H](/C=C/C(O)Cc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C15H16F2O2/c16-14-6-3-11(9-15(14)17)8-13(19)5-2-10-1-4-12(18)7-10/h2-3,5-6,9-10,13,19H,1,4,7-8H2/b5-2+/t10-,13?/m1/s1 |
| InChIKey | ZFMONSPLNQJCRX-WVPMUFPWSA-N |
| XLogP | 2.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|