About 1-chloro-4-(4-methylphenyl)benzene;methanol;methylidenecyclopropane
1-chloro-4-(4-methylphenyl)benzene;methanol;methylidenecyclopropane (PubChem CID 144971692) has the molecular formula C18H21ClO
and a molecular weight of 288.82 g/mol. Its IUPAC name is 1-chloro-4-(4-methylphenyl)benzene;methanol;methylidenecyclopropane.
Molecular Properties
| Compound Name | 1-chloro-4-(4-methylphenyl)benzene;methanol;methylidenecyclopropane |
| PubChem CID | 144971692 |
| Molecular Formula | C18H21ClO |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-chloro-4-(4-methylphenyl)benzene;methanol;methylidenecyclopropane |
| SMILES | C=C1CC1.CO.Cc1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C13H11Cl.C4H6.CH4O/c1-10-2-4-11(5-3-10)12-6-8-13(14)9-7-12;1-4-2-3-4;1-2/h2-9H,1H3;1-3H2;2H,1H3 |
| InChIKey | BYVQHTADZXESBM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-(4-methylphenyl)benzene;methanol;methylidenecyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-(4-methylphenyl)benzene;methanol;methylidenecyclopropane?
The IUPAC name of 1-chloro-4-(4-methylphenyl)benzene;methanol;methylidenecyclopropane (CID 144971692) is 1-chloro-4-(4-methylphenyl)benzene;methanol;methylidenecyclopropane.
What is the SMILES notation for 1-chloro-4-(4-methylphenyl)benzene;methanol;methylidenecyclopropane?
The canonical SMILES for 1-chloro-4-(4-methylphenyl)benzene;methanol;methylidenecyclopropane is C=C1CC1.CO.Cc1ccc(-c2ccc(Cl)cc2)cc1.
What is the InChIKey of 1-chloro-4-(4-methylphenyl)benzene;methanol;methylidenecyclopropane?
The InChIKey is BYVQHTADZXESBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl.C4H6.CH4O/c1-10-2-4-11(5-3-10)12-6-8-13(14)9-7-12;1-4-2-3-4;1-2/h2-9H,1H3;1-3H2;2H,1H3.
What are the key properties of 1-chloro-4-(4-methylphenyl)benzene;methanol;methylidenecyclopropane?
1-chloro-4-(4-methylphenyl)benzene;methanol;methylidenecyclopropane has a molecular weight of 288.82 g/mol, XLogP of 5.26, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-(4-methylphenyl)benzene;methanol;methylidenecyclopropane is sourced from PubChem (CID 144971692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).