C24H27N5O — CID 144977605
N'-diazenyl-4-(4-methylphenyl)-2-oxo-6-(4-pentylphenyl)-1H-pyridine-3-carboximidamide (PubChem CID 144977605) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is N'-diazenyl-4-(4-methylphenyl)-2-oxo-6-(4-pentylphenyl)-1H-pyridine-3-carboximidamide.
| Compound Name | N'-diazenyl-4-(4-methylphenyl)-2-oxo-6-(4-pentylphenyl)-1H-pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 144977605 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | N'-diazenyl-4-(4-methylphenyl)-2-oxo-6-(4-pentylphenyl)-1H-pyridine-3-carboximidamide |
| SMILES | [H]/N=N/N=C(N)c1c(-c2ccc(C)cc2)cc(-c2ccc(CCCCC)cc2)[nH]c1=O |
| InChI | InChI=1S/C24H27N5O/c1-3-4-5-6-17-9-13-19(14-10-17)21-15-20(18-11-7-16(2)8-12-18)22(24(30)27-21)23(25)28-29-26/h7-15H,3-6H2,1-2H3,(H,27,30)(H3,25,26,28) |
| InChIKey | QTSMMPXEXJSFQB-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|