C42H61F3O7S — CID 144981191
benzyl formate;[(2R,8S,23R)-6,10,10,15,15,19,23,24-octamethyl-9,11-dioxahexacyclo[10.10.2.02,6.08,23.014,19.020,24]tetracos-16-en-16-yl] trifluoromethanesulfonate;prop-1-ene (PubChem CID 144981191) has the molecular formula C42H61F3O7S and a molecular weight of 767.00 g/mol. Its IUPAC name is benzyl formate;[(2R,8S,23R)-6,10,10,15,15,19,23,24-octamethyl-9,11-dioxahexacyclo[10.10.2.02,6.08,23.014,19.020,24]tetracos-16-en-16-yl] trifluoromethanesulfonate;prop-1-ene.
| Compound Name | benzyl formate;[(2R,8S,23R)-6,10,10,15,15,19,23,24-octamethyl-9,11-dioxahexacyclo[10.10.2.02,6.08,23.014,19.020,24]tetracos-16-en-16-yl] trifluoromethanesulfonate;prop-1-ene |
|---|---|
| PubChem CID | 144981191 |
| Molecular Formula | C42H61F3O7S |
| Molecular Weight | 767.00 g/mol |
| Exact Mass | 766.41 |
| IUPAC Name | benzyl formate;[(2R,8S,23R)-6,10,10,15,15,19,23,24-octamethyl-9,11-dioxahexacyclo[10.10.2.02,6.08,23.014,19.020,24]tetracos-16-en-16-yl] trifluoromethanesulfonate;prop-1-ene |
| SMILES | C=CC.CC1(C)OC2CC3C(C)(C)C(OS(=O)(=O)C(F)(F)F)=CCC3(C)C3CCC4[C@H]5CCCC5(C)C[C@H](O1)[C@@]4(C)C23C.O=COCc1ccccc1 |
| InChI | InChI=1S/C31H47F3O5S.C8H8O2.C3H6/c1-25(2)21-16-23-30(8)20(28(21,6)15-13-22(25)39-40(35,36)31(32,33)34)12-11-19-18-10-9-14-27(18,5)17-24(29(19,30)7)38-26(3,4)37-23;9-7-10-6-8-4-2-1-3-5-8;1-3-2/h13,18-21,23-24H,9-12,14-17H2,1-8H3;1-5,7H,6H2;3H,1H2,2H3/t18-,19?,20?,21?,23?,24+,27?,28?,29+,30?;;/m1../s1 |
| InChIKey | CCTXMVQVBJFFOX-SHHOUHDLSA-N |
| XLogP | 10.51 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.00 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|