C37H28N4 — CID 144995361
8-(4,6-diphenyl-2-pyridinyl)-15-[(2E,4Z)-hexa-2,4-dien-3-yl]-3,5,8-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene (PubChem CID 144995361) has the molecular formula C37H28N4 and a molecular weight of 528.66 g/mol. Its IUPAC name is 8-(4,6-diphenyl-2-pyridinyl)-15-[(2E,4Z)-hexa-2,4-dien-3-yl]-3,5,8-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene.
| Compound Name | 8-(4,6-diphenyl-2-pyridinyl)-15-[(2E,4Z)-hexa-2,4-dien-3-yl]-3,5,8-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene |
|---|---|
| PubChem CID | 144995361 |
| Molecular Formula | C37H28N4 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 8-(4,6-diphenyl-2-pyridinyl)-15-[(2E,4Z)-hexa-2,4-dien-3-yl]-3,5,8-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene |
| SMILES | C/C=C\C(=C/C)c1cc2c3c(cccc3c1)N(c1cc(-c3ccccc3)cc(-c3ccccc3)n1)c1cncnc1-2 |
| InChI | InChI=1S/C37H28N4/c1-3-12-25(4-2)29-19-28-17-11-18-33-36(28)31(20-29)37-34(23-38-24-39-37)41(33)35-22-30(26-13-7-5-8-14-26)21-32(40-35)27-15-9-6-10-16-27/h3-24H,1-2H3/b12-3-,25-4+ |
| InChIKey | GWWZUAORWCWLCM-HYXJCTBNSA-N |
| XLogP | 9.79 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|