C8H10F3N2O2P — CID 145018907
1-(4-amino-2,2,3-trifluoro-3-phosphanylbutyl)pyrrole-2,5-dione (PubChem CID 145018907) has the molecular formula C8H10F3N2O2P and a molecular weight of 254.15 g/mol. Its IUPAC name is 1-(4-amino-2,2,3-trifluoro-3-phosphanylbutyl)pyrrole-2,5-dione.
| Compound Name | 1-(4-amino-2,2,3-trifluoro-3-phosphanylbutyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 145018907 |
| Molecular Formula | C8H10F3N2O2P |
| Molecular Weight | 254.15 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 1-(4-amino-2,2,3-trifluoro-3-phosphanylbutyl)pyrrole-2,5-dione |
| SMILES | NCC(F)(P)C(F)(F)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C8H10F3N2O2P/c9-7(10,8(11,16)3-12)4-13-5(14)1-2-6(13)15/h1-2H,3-4,12,16H2 |
| InChIKey | VMDNUGBRHHGFSP-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.15 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|