About ethane;3-ethyl-1-methylpyridin-2-one;1-methylpiperidin-2-one
ethane;3-ethyl-1-methylpyridin-2-one;1-methylpiperidin-2-one (PubChem CID 145026761) has the molecular formula C18H34N2O2
and a molecular weight of 310.48 g/mol. Its IUPAC name is ethane;3-ethyl-1-methylpyridin-2-one;1-methylpiperidin-2-one.
Molecular Properties
| Compound Name | ethane;3-ethyl-1-methylpyridin-2-one;1-methylpiperidin-2-one |
| PubChem CID | 145026761 |
| Molecular Formula | C18H34N2O2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.26 |
| IUPAC Name | ethane;3-ethyl-1-methylpyridin-2-one;1-methylpiperidin-2-one |
| SMILES | CC.CC.CCc1cccn(C)c1=O.CN1CCCCC1=O |
| InChI | InChI=1S/C8H11NO.C6H11NO.2C2H6/c1-3-7-5-4-6-9(2)8(7)10;1-7-5-3-2-4-6(7)8;2*1-2/h4-6H,3H2,1-2H3;2-5H2,1H3;2*1-2H3 |
| InChIKey | FLIIBTJIZNAWCV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;3-ethyl-1-methylpyridin-2-one;1-methylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-ethyl-1-methylpyridin-2-one;1-methylpiperidin-2-one?
The IUPAC name of ethane;3-ethyl-1-methylpyridin-2-one;1-methylpiperidin-2-one (CID 145026761) is ethane;3-ethyl-1-methylpyridin-2-one;1-methylpiperidin-2-one.
What is the SMILES notation for ethane;3-ethyl-1-methylpyridin-2-one;1-methylpiperidin-2-one?
The canonical SMILES for ethane;3-ethyl-1-methylpyridin-2-one;1-methylpiperidin-2-one is CC.CC.CCc1cccn(C)c1=O.CN1CCCCC1=O.
What is the InChIKey of ethane;3-ethyl-1-methylpyridin-2-one;1-methylpiperidin-2-one?
The InChIKey is FLIIBTJIZNAWCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.C6H11NO.2C2H6/c1-3-7-5-4-6-9(2)8(7)10;1-7-5-3-2-4-6(7)8;2*1-2/h4-6H,3H2,1-2H3;2-5H2,1H3;2*1-2H3.
What are the key properties of ethane;3-ethyl-1-methylpyridin-2-one;1-methylpiperidin-2-one?
ethane;3-ethyl-1-methylpyridin-2-one;1-methylpiperidin-2-one has a molecular weight of 310.48 g/mol, XLogP of 3.63, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethyl-1-methylpyridin-2-one;1-methylpiperidin-2-one is sourced from PubChem (CID 145026761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).