C13H14ClIN4OS — CID 145053344
5-chloro-2-iodo-N-[2-(propan-2-ylsulfonimidoyl)phenyl]pyrimidin-4-amine (PubChem CID 145053344) has the molecular formula C13H14ClIN4OS and a molecular weight of 436.71 g/mol. Its IUPAC name is 5-chloro-2-iodo-N-[2-(propan-2-ylsulfonimidoyl)phenyl]pyrimidin-4-amine.
| Compound Name | 5-chloro-2-iodo-N-[2-(propan-2-ylsulfonimidoyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 145053344 |
| Molecular Formula | C13H14ClIN4OS |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 435.96 |
| IUPAC Name | 5-chloro-2-iodo-N-[2-(propan-2-ylsulfonimidoyl)phenyl]pyrimidin-4-amine |
| SMILES | [H]N=S(=O)(c1ccccc1Nc1nc(I)ncc1Cl)C(C)C |
| InChI | InChI=1S/C13H14ClIN4OS/c1-8(2)21(16,20)11-6-4-3-5-10(11)18-12-9(14)7-17-13(15)19-12/h3-8,16H,1-2H3,(H,17,18,19) |
| InChIKey | WMPRCMSGPGWPLA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|