C30H33N5O4 — CID 145059666
N-[C-[(Z)-but-1-enyl]-N-methylcarbonimidoyl]-4-[6-(but-2-ynoylamino)-7-[2-(dimethylamino)ethoxy]quinolin-4-yl]oxybenzamide (PubChem CID 145059666) has the molecular formula C30H33N5O4 and a molecular weight of 527.63 g/mol. Its IUPAC name is N-[C-[(Z)-but-1-enyl]-N-methylcarbonimidoyl]-4-[6-(but-2-ynoylamino)-7-[2-(dimethylamino)ethoxy]quinolin-4-yl]oxybenzamide.
| Compound Name | N-[C-[(Z)-but-1-enyl]-N-methylcarbonimidoyl]-4-[6-(but-2-ynoylamino)-7-[2-(dimethylamino)ethoxy]quinolin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 145059666 |
| Molecular Formula | C30H33N5O4 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | N-[C-[(Z)-but-1-enyl]-N-methylcarbonimidoyl]-4-[6-(but-2-ynoylamino)-7-[2-(dimethylamino)ethoxy]quinolin-4-yl]oxybenzamide |
| SMILES | CC#CC(=O)Nc1cc2c(Oc3ccc(C(=O)NC(/C=C\CC)=N/C)cc3)ccnc2cc1OCCN(C)C |
| InChI | InChI=1S/C30H33N5O4/c1-6-8-10-28(31-3)34-30(37)21-11-13-22(14-12-21)39-26-15-16-32-24-20-27(38-18-17-35(4)5)25(19-23(24)26)33-29(36)9-7-2/h8,10-16,19-20H,6,17-18H2,1-5H3,(H,33,36)(H,31,34,37)/b10-8- |
| InChIKey | JJWBFALUKQXMDE-NTMALXAHSA-N |
| XLogP | 4.65 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|