C18H21N3 — CID 145085051
N'-[amino(phenyl)methyl]-1-(3,4-dihydronaphthalen-2-yl)methanediamine (PubChem CID 145085051) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is N'-[amino(phenyl)methyl]-1-(3,4-dihydronaphthalen-2-yl)methanediamine.
| Compound Name | N'-[amino(phenyl)methyl]-1-(3,4-dihydronaphthalen-2-yl)methanediamine |
|---|---|
| PubChem CID | 145085051 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N'-[amino(phenyl)methyl]-1-(3,4-dihydronaphthalen-2-yl)methanediamine |
| SMILES | NC(NC(N)c1ccccc1)C1=Cc2ccccc2CC1 |
| InChI | InChI=1S/C18H21N3/c19-17(14-7-2-1-3-8-14)21-18(20)16-11-10-13-6-4-5-9-15(13)12-16/h1-9,12,17-18,21H,10-11,19-20H2 |
| InChIKey | NSCABLIKRCCAFH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|