C39H46O5S — CID 145126302
2-[3-methyl-3-[[3-phenyl-5,7-bis(1-phenylethyl)-2,3-dihydro-1H-inden-4-yl]oxy]butoxy]propane-2-sulfonic acid (PubChem CID 145126302) has the molecular formula C39H46O5S and a molecular weight of 626.86 g/mol. Its IUPAC name is 2-[3-methyl-3-[[3-phenyl-5,7-bis(1-phenylethyl)-2,3-dihydro-1H-inden-4-yl]oxy]butoxy]propane-2-sulfonic acid.
| Compound Name | 2-[3-methyl-3-[[3-phenyl-5,7-bis(1-phenylethyl)-2,3-dihydro-1H-inden-4-yl]oxy]butoxy]propane-2-sulfonic acid |
|---|---|
| PubChem CID | 145126302 |
| Molecular Formula | C39H46O5S |
| Molecular Weight | 626.86 g/mol |
| Exact Mass | 626.31 |
| IUPAC Name | 2-[3-methyl-3-[[3-phenyl-5,7-bis(1-phenylethyl)-2,3-dihydro-1H-inden-4-yl]oxy]butoxy]propane-2-sulfonic acid |
| SMILES | CC(c1ccccc1)c1cc(C(C)c2ccccc2)c(OC(C)(C)CCOC(C)(C)S(=O)(=O)O)c2c1CCC2c1ccccc1 |
| InChI | InChI=1S/C39H46O5S/c1-27(29-16-10-7-11-17-29)34-26-35(28(2)30-18-12-8-13-19-30)37(36-32(22-23-33(34)36)31-20-14-9-15-21-31)44-38(3,4)24-25-43-39(5,6)45(40,41)42/h7-21,26-28,32H,22-25H2,1-6H3,(H,40,41,42) |
| InChIKey | KRPCJFXNJJLGFZ-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.86 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|