C24H34N6O6 — CID 145152464
5-(aminomethylideneamino)-2-[[(4Z)-13-(methylamino)-9,12-dioxo-2-oxa-8,11-diazabicyclo[13.2.2]nonadeca-1(17),4,15,18-tetraene-7-carbonyl]amino]pentanoic acid (PubChem CID 145152464) has the molecular formula C24H34N6O6 and a molecular weight of 502.57 g/mol. Its IUPAC name is 5-(aminomethylideneamino)-2-[[(4Z)-13-(methylamino)-9,12-dioxo-2-oxa-8,11-diazabicyclo[13.2.2]nonadeca-1(17),4,15,18-tetraene-7-carbonyl]amino]pentanoic acid.
| Compound Name | 5-(aminomethylideneamino)-2-[[(4Z)-13-(methylamino)-9,12-dioxo-2-oxa-8,11-diazabicyclo[13.2.2]nonadeca-1(17),4,15,18-tetraene-7-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 145152464 |
| Molecular Formula | C24H34N6O6 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | 5-(aminomethylideneamino)-2-[[(4Z)-13-(methylamino)-9,12-dioxo-2-oxa-8,11-diazabicyclo[13.2.2]nonadeca-1(17),4,15,18-tetraene-7-carbonyl]amino]pentanoic acid |
| SMILES | CNC1Cc2ccc(cc2)OC/C=C\CC(C(=O)NC(CCC/N=C/N)C(=O)O)NC(=O)CNC1=O |
| InChI | InChI=1S/C24H34N6O6/c1-26-20-13-16-7-9-17(10-8-16)36-12-3-2-5-18(29-21(31)14-28-22(20)32)23(33)30-19(24(34)35)6-4-11-27-15-25/h2-3,7-10,15,18-20,26H,4-6,11-14H2,1H3,(H2,25,27)(H,28,32)(H,29,31)(H,30,33)(H,34,35)/b3-2- |
| InChIKey | YYDKQJYVVKGRFX-IHWYPQMZSA-N |
| XLogP | -0.91 |
| TPSA | 184.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|