C16H17F — CID 145154509
(3Z,9Z)-2-fluoro-3,11-dimethyl-5,8-dimethylidenedodeca-1,3,9,11-tetraen-6-yne (PubChem CID 145154509) has the molecular formula C16H17F and a molecular weight of 228.31 g/mol. Its IUPAC name is (3Z,9Z)-2-fluoro-3,11-dimethyl-5,8-dimethylidenedodeca-1,3,9,11-tetraen-6-yne.
| Compound Name | (3Z,9Z)-2-fluoro-3,11-dimethyl-5,8-dimethylidenedodeca-1,3,9,11-tetraen-6-yne |
|---|---|
| PubChem CID | 145154509 |
| Molecular Formula | C16H17F |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (3Z,9Z)-2-fluoro-3,11-dimethyl-5,8-dimethylidenedodeca-1,3,9,11-tetraen-6-yne |
| SMILES | C=C(C)/C=C\C(=C)C#CC(=C)/C=C(/C)C(=C)F |
| InChI | InChI=1S/C16H17F/c1-12(2)7-8-13(3)9-10-14(4)11-15(5)16(6)17/h7-8,11H,1,3-4,6H2,2,5H3/b8-7-,15-11- |
| InChIKey | RSJJUDNKMRWSKI-FGTQOCLDSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|