C18H18FN5O3 — CID 145159424
N-[amino(1H-pyrrolo[2,3-b]pyridin-3-yl)methylidene]-3-hydroxypropanamide;4-fluorobenzamide (PubChem CID 145159424) has the molecular formula C18H18FN5O3 and a molecular weight of 371.37 g/mol. Its IUPAC name is N-[amino(1H-pyrrolo[2,3-b]pyridin-3-yl)methylidene]-3-hydroxypropanamide;4-fluorobenzamide.
| Compound Name | N-[amino(1H-pyrrolo[2,3-b]pyridin-3-yl)methylidene]-3-hydroxypropanamide;4-fluorobenzamide |
|---|---|
| PubChem CID | 145159424 |
| Molecular Formula | C18H18FN5O3 |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N-[amino(1H-pyrrolo[2,3-b]pyridin-3-yl)methylidene]-3-hydroxypropanamide;4-fluorobenzamide |
| SMILES | N/C(=N\C(=O)CCO)c1c[nH]c2ncccc12.NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H12N4O2.C7H6FNO/c12-10(15-9(17)3-5-16)8-6-14-11-7(8)2-1-4-13-11;8-6-3-1-5(2-4-6)7(9)10/h1-2,4,6,16H,3,5H2,(H,13,14)(H2,12,15,17);1-4H,(H2,9,10) |
| InChIKey | KVEXFVVJEKLBDB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 147.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|