C13H27NO — CID 145166301
(5Z)-N-ethyl-N-methylhepta-3,5-dien-3-amine;methoxyethane (PubChem CID 145166301) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is (5Z)-N-ethyl-N-methylhepta-3,5-dien-3-amine;methoxyethane.
| Compound Name | (5Z)-N-ethyl-N-methylhepta-3,5-dien-3-amine;methoxyethane |
|---|---|
| PubChem CID | 145166301 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | (5Z)-N-ethyl-N-methylhepta-3,5-dien-3-amine;methoxyethane |
| SMILES | C/C=C\C=C(CC)N(C)CC.CCOC |
| InChI | InChI=1S/C10H19N.C3H8O/c1-5-8-9-10(6-2)11(4)7-3;1-3-4-2/h5,8-9H,6-7H2,1-4H3;3H2,1-2H3/b8-5-,10-9?; |
| InChIKey | YJSMMGMHMMFMJE-REHRGPRSSA-N |
| XLogP | 3.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|