C29H55N5O5S — CID 145169258
6-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-[1-[[2-[[2-methoxy-3-(2-methylpropylamino)propyl]amino]-2-oxoethyl]amino]-2-methylpropyl]-N-methylhexanamide (PubChem CID 145169258) has the molecular formula C29H55N5O5S and a molecular weight of 585.86 g/mol. Its IUPAC name is 6-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-[1-[[2-[[2-methoxy-3-(2-methylpropylamino)propyl]amino]-2-oxoethyl]amino]-2-methylpropyl]-N-methylhexanamide.
| Compound Name | 6-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-[1-[[2-[[2-methoxy-3-(2-methylpropylamino)propyl]amino]-2-oxoethyl]amino]-2-methylpropyl]-N-methylhexanamide |
|---|---|
| PubChem CID | 145169258 |
| Molecular Formula | C29H55N5O5S |
| Molecular Weight | 585.86 g/mol |
| Exact Mass | 585.39 |
| IUPAC Name | 6-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-[1-[[2-[[2-methoxy-3-(2-methylpropylamino)propyl]amino]-2-oxoethyl]amino]-2-methylpropyl]-N-methylhexanamide |
| SMILES | CCCCSC1CC(=O)N(CCCCCC(=O)N(C)C(NCC(=O)NCC(CNCC(C)C)OC)C(C)C)C1=O |
| InChI | InChI=1S/C29H55N5O5S/c1-8-9-15-40-24-16-27(37)34(29(24)38)14-12-10-11-13-26(36)33(6)28(22(4)5)32-20-25(35)31-19-23(39-7)18-30-17-21(2)3/h21-24,28,30,32H,8-20H2,1-7H3,(H,31,35) |
| InChIKey | FBWREFAGGCDVMV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.86 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|