C35H64N6O6S — CID 159109336
2-[7-[1-[5-[(tert-butylamino)methylamino]-5-oxopentyl]-2,5-dioxopyrrolidin-3-yl]sulfanylheptanoyl-methylamino]-N-[2-(dimethylamino)ethyl]-N,5,5-trimethyl-4-oxohexanamide (PubChem CID 159109336) has the molecular formula C35H64N6O6S and a molecular weight of 697.00 g/mol. Its IUPAC name is 2-[7-[1-[5-[(tert-butylamino)methylamino]-5-oxopentyl]-2,5-dioxopyrrolidin-3-yl]sulfanylheptanoyl-methylamino]-N-[2-(dimethylamino)ethyl]-N,5,5-trimethyl-4-oxohexanamide.
| Compound Name | 2-[7-[1-[5-[(tert-butylamino)methylamino]-5-oxopentyl]-2,5-dioxopyrrolidin-3-yl]sulfanylheptanoyl-methylamino]-N-[2-(dimethylamino)ethyl]-N,5,5-trimethyl-4-oxohexanamide |
|---|---|
| PubChem CID | 159109336 |
| Molecular Formula | C35H64N6O6S |
| Molecular Weight | 697.00 g/mol |
| Exact Mass | 696.46 |
| IUPAC Name | 2-[7-[1-[5-[(tert-butylamino)methylamino]-5-oxopentyl]-2,5-dioxopyrrolidin-3-yl]sulfanylheptanoyl-methylamino]-N-[2-(dimethylamino)ethyl]-N,5,5-trimethyl-4-oxohexanamide |
| SMILES | CN(C)CCN(C)C(=O)C(CC(=O)C(C)(C)C)N(C)C(=O)CCCCCCSC1CC(=O)N(CCCCC(=O)NCNC(C)(C)C)C1=O |
| InChI | InChI=1S/C35H64N6O6S/c1-34(2,3)28(42)23-26(32(46)39(9)21-20-38(7)8)40(10)30(44)18-13-11-12-16-22-48-27-24-31(45)41(33(27)47)19-15-14-17-29(43)36-25-37-35(4,5)6/h26-27,37H,11-25H2,1-10H3,(H,36,43) |
| InChIKey | UZGIDOALSJSEIX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.00 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|