C19H31N — CID 145196787
3,6-dimethyl-2-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]pyridine;ethane (PubChem CID 145196787) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is 3,6-dimethyl-2-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]pyridine;ethane.
| Compound Name | 3,6-dimethyl-2-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]pyridine;ethane |
|---|---|
| PubChem CID | 145196787 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 3,6-dimethyl-2-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]pyridine;ethane |
| SMILES | C=C/C=C\C(=C(C)C)c1nc(C)ccc1C.CC.CC |
| InChI | InChI=1S/C15H19N.2C2H6/c1-6-7-8-14(11(2)3)15-12(4)9-10-13(5)16-15;2*1-2/h6-10H,1H2,2-5H3;2*1-2H3/b8-7-;; |
| InChIKey | AXUGBOBHNNAVDH-OTMFCZTRSA-N |
| XLogP | 6.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|