C31H47B2FN2O5 — CID 145199939
5-[(Z)-2-cyclobutyl-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-(1-ethoxybutyl)-3-fluoroindazole (PubChem CID 145199939) has the molecular formula C31H47B2FN2O5 and a molecular weight of 568.35 g/mol. Its IUPAC name is 5-[(Z)-2-cyclobutyl-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-(1-ethoxybutyl)-3-fluoroindazole.
| Compound Name | 5-[(Z)-2-cyclobutyl-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-(1-ethoxybutyl)-3-fluoroindazole |
|---|---|
| PubChem CID | 145199939 |
| Molecular Formula | C31H47B2FN2O5 |
| Molecular Weight | 568.35 g/mol |
| Exact Mass | 568.37 |
| IUPAC Name | 5-[(Z)-2-cyclobutyl-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-(1-ethoxybutyl)-3-fluoroindazole |
| SMILES | CCCC(OCC)n1nc(F)c2cc(/C(B3OC(C)(C)C(C)(C)O3)=C(/B3OC(C)(C)C(C)(C)O3)C3CCC3)ccc21 |
| InChI | InChI=1S/C31H47B2FN2O5/c1-11-14-24(37-12-2)36-23-18-17-21(19-22(23)27(34)35-36)26(33-40-30(7,8)31(9,10)41-33)25(20-15-13-16-20)32-38-28(3,4)29(5,6)39-32/h17-20,24H,11-16H2,1-10H3/b26-25- |
| InChIKey | JOWFHUBURUWSJS-QPLCGJKRSA-N |
| XLogP | 7.33 |
| TPSA | 63.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.35 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|