C11H17F2N3O — CID 145206830
4-(aminomethyl)-3,5-difluoro-N'-methoxybenzenecarboximidamide;ethane (PubChem CID 145206830) has the molecular formula C11H17F2N3O and a molecular weight of 245.27 g/mol. Its IUPAC name is 4-(aminomethyl)-3,5-difluoro-N'-methoxybenzenecarboximidamide;ethane.
| Compound Name | 4-(aminomethyl)-3,5-difluoro-N'-methoxybenzenecarboximidamide;ethane |
|---|---|
| PubChem CID | 145206830 |
| Molecular Formula | C11H17F2N3O |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 4-(aminomethyl)-3,5-difluoro-N'-methoxybenzenecarboximidamide;ethane |
| SMILES | CC.CO/N=C(\N)c1cc(F)c(CN)c(F)c1 |
| InChI | InChI=1S/C9H11F2N3O.C2H6/c1-15-14-9(13)5-2-7(10)6(4-12)8(11)3-5;1-2/h2-3H,4,12H2,1H3,(H2,13,14);1-2H3 |
| InChIKey | VTLDUNZUKPAPOX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|