C23H24F2O3 — CID 145218879
3-ethoxyprop-1-ene;2-[(1Z)-3-fluorobuta-1,3-dienyl]xanthen-9-one;fluoromethane (PubChem CID 145218879) has the molecular formula C23H24F2O3 and a molecular weight of 386.44 g/mol. Its IUPAC name is 3-ethoxyprop-1-ene;2-[(1Z)-3-fluorobuta-1,3-dienyl]xanthen-9-one;fluoromethane.
| Compound Name | 3-ethoxyprop-1-ene;2-[(1Z)-3-fluorobuta-1,3-dienyl]xanthen-9-one;fluoromethane |
|---|---|
| PubChem CID | 145218879 |
| Molecular Formula | C23H24F2O3 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 3-ethoxyprop-1-ene;2-[(1Z)-3-fluorobuta-1,3-dienyl]xanthen-9-one;fluoromethane |
| SMILES | C=C(F)/C=C\c1ccc2oc3ccccc3c(=O)c2c1.C=CCOCC.CF |
| InChI | InChI=1S/C17H11FO2.C5H10O.CH3F/c1-11(18)6-7-12-8-9-16-14(10-12)17(19)13-4-2-3-5-15(13)20-16;1-3-5-6-4-2;1-2/h2-10H,1H2;3H,1,4-5H2,2H3;1H3/b7-6-;; |
| InChIKey | KAQDSOMXVNHIRR-AQTVDGORSA-N |
| XLogP | 6.24 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|