C26H32N4O8 — CID 145227837
4-[6-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]-2-pyridinyl]phthalic acid (PubChem CID 145227837) has the molecular formula C26H32N4O8 and a molecular weight of 528.56 g/mol. Its IUPAC name is 4-[6-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]-2-pyridinyl]phthalic acid.
| Compound Name | 4-[6-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]-2-pyridinyl]phthalic acid |
|---|---|
| PubChem CID | 145227837 |
| Molecular Formula | C26H32N4O8 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | 4-[6-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]-2-pyridinyl]phthalic acid |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1cccc(-c2ccc(C(=O)O)c(C(=O)O)c2)n1)C(CC)N(O)C=O |
| InChI | InChI=1S/C26H32N4O8/c1-3-5-6-8-18(22(4-2)30(38)15-31)23(32)27-14-28-24(33)21-10-7-9-20(29-21)16-11-12-17(25(34)35)19(13-16)26(36)37/h7,9-13,15,18,22,38H,3-6,8,14H2,1-2H3,(H,27,32)(H,28,33)(H,34,35)(H,36,37) |
| InChIKey | KPQHTDACJVJWDR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 186.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|