C27H38N3O8P — CID 154505329
[2-ethoxy-4-[3-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]phenyl]phenyl]phosphonic acid (PubChem CID 154505329) has the molecular formula C27H38N3O8P and a molecular weight of 563.59 g/mol. Its IUPAC name is [2-ethoxy-4-[3-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]phenyl]phenyl]phosphonic acid.
| Compound Name | [2-ethoxy-4-[3-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]phenyl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 154505329 |
| Molecular Formula | C27H38N3O8P |
| Molecular Weight | 563.59 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | [2-ethoxy-4-[3-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]phenyl]phenyl]phosphonic acid |
| SMILES | CCCCC[C@@H](C(=O)NCNC(=O)c1cccc(-c2ccc(P(=O)(O)O)c(OCC)c2)c1)[C@@H](CC)N(O)C=O |
| InChI | InChI=1S/C27H38N3O8P/c1-4-7-8-12-22(23(5-2)30(34)18-31)27(33)29-17-28-26(32)21-11-9-10-19(15-21)20-13-14-25(39(35,36)37)24(16-20)38-6-3/h9-11,13-16,18,22-23,34H,4-8,12,17H2,1-3H3,(H,28,32)(H,29,33)(H2,35,36,37)/t22-,23-/m1/s1 |
| InChIKey | QKGAJYRKHWRULS-DHIUTWEWSA-N |
| XLogP | 3.18 |
| TPSA | 165.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.59 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|