C24H35BN4O8 — CID 145227715
N-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methyl]-3-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzamide (PubChem CID 145227715) has the molecular formula C24H35BN4O8 and a molecular weight of 518.38 g/mol. Its IUPAC name is N-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methyl]-3-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzamide.
| Compound Name | N-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methyl]-3-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzamide |
|---|---|
| PubChem CID | 145227715 |
| Molecular Formula | C24H35BN4O8 |
| Molecular Weight | 518.38 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | N-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methyl]-3-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzamide |
| SMILES | CCCCC[C@@H](C(=O)NCNC(=O)c1cccc(B2OC(=O)CN(C)CC(=O)O2)c1)[C@@H](CC)N(O)C=O |
| InChI | InChI=1S/C24H35BN4O8/c1-4-6-7-11-19(20(5-2)29(35)16-30)24(34)27-15-26-23(33)17-9-8-10-18(12-17)25-36-21(31)13-28(3)14-22(32)37-25/h8-10,12,16,19-20,35H,4-7,11,13-15H2,1-3H3,(H,26,33)(H,27,34)/t19-,20-/m1/s1 |
| InChIKey | QEELQLPPZCDFMJ-WOJBJXKFSA-N |
| XLogP | 0.04 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.38 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|