C28H38N4O8S — CID 144883902
2-[[3-ethoxy-5-[5-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]thiophen-2-yl]benzoyl]amino]acetic acid (PubChem CID 144883902) has the molecular formula C28H38N4O8S and a molecular weight of 590.70 g/mol. Its IUPAC name is 2-[[3-ethoxy-5-[5-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]thiophen-2-yl]benzoyl]amino]acetic acid.
| Compound Name | 2-[[3-ethoxy-5-[5-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]thiophen-2-yl]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 144883902 |
| Molecular Formula | C28H38N4O8S |
| Molecular Weight | 590.70 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | 2-[[3-ethoxy-5-[5-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]thiophen-2-yl]benzoyl]amino]acetic acid |
| SMILES | CCCCCC(C(=O)NCNC(=O)c1ccc(-c2cc(OCC)cc(C(=O)NCC(=O)O)c2)s1)C(CC)N(O)C=O |
| InChI | InChI=1S/C28H38N4O8S/c1-4-7-8-9-21(22(5-2)32(39)17-33)27(37)30-16-31-28(38)24-11-10-23(41-24)18-12-19(14-20(13-18)40-6-3)26(36)29-15-25(34)35/h10-14,17,21-22,39H,4-9,15-16H2,1-3H3,(H,29,36)(H,30,37)(H,31,38)(H,34,35) |
| InChIKey | SGTDCTUOGYGFOS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 174.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.70 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|