C12H25N3O3 — CID 118225714
(2R)-N-(aminomethyl)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanamide (PubChem CID 118225714) has the molecular formula C12H25N3O3 and a molecular weight of 259.35 g/mol. Its IUPAC name is (2R)-N-(aminomethyl)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanamide.
| Compound Name | (2R)-N-(aminomethyl)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanamide |
|---|---|
| PubChem CID | 118225714 |
| Molecular Formula | C12H25N3O3 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (2R)-N-(aminomethyl)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanamide |
| SMILES | CCCCC[C@@H](C(=O)NCN)[C@@H](CC)N(O)C=O |
| InChI | InChI=1S/C12H25N3O3/c1-3-5-6-7-10(12(17)14-8-13)11(4-2)15(18)9-16/h9-11,18H,3-8,13H2,1-2H3,(H,14,17)/t10-,11-/m1/s1 |
| InChIKey | HQVOSUGRNZOVIH-GHMZBOCLSA-N |
| XLogP | 0.84 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|