C25H40N3O9P — CID 146176553
[3-ethoxy-5-[5-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]oxolan-2-yl]phenyl]phosphonic acid (PubChem CID 146176553) has the molecular formula C25H40N3O9P and a molecular weight of 557.58 g/mol. Its IUPAC name is [3-ethoxy-5-[5-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]oxolan-2-yl]phenyl]phosphonic acid.
| Compound Name | [3-ethoxy-5-[5-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]oxolan-2-yl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 146176553 |
| Molecular Formula | C25H40N3O9P |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | [3-ethoxy-5-[5-[[2-[1-[formyl(hydroxy)amino]propyl]heptanoylamino]methylcarbamoyl]oxolan-2-yl]phenyl]phosphonic acid |
| SMILES | CCCCCC(C(=O)NCNC(=O)C1CCC(c2cc(OCC)cc(P(=O)(O)O)c2)O1)C(CC)N(O)C=O |
| InChI | InChI=1S/C25H40N3O9P/c1-4-7-8-9-20(21(5-2)28(32)16-29)24(30)26-15-27-25(31)23-11-10-22(37-23)17-12-18(36-6-3)14-19(13-17)38(33,34)35/h12-14,16,20-23,32H,4-11,15H2,1-3H3,(H,26,30)(H,27,31)(H2,33,34,35) |
| InChIKey | BZBSXKWKRVCNGR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 174.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|