C23H43N — CID 145242402
butane;ethane;(3Z,5Z)-3-[1-(1-methylcyclopropyl)propan-2-ylidene]-N-propan-2-ylhepta-1,5-dien-4-imine (PubChem CID 145242402) has the molecular formula C23H43N and a molecular weight of 333.60 g/mol. Its IUPAC name is butane;ethane;(3Z,5Z)-3-[1-(1-methylcyclopropyl)propan-2-ylidene]-N-propan-2-ylhepta-1,5-dien-4-imine.
| Compound Name | butane;ethane;(3Z,5Z)-3-[1-(1-methylcyclopropyl)propan-2-ylidene]-N-propan-2-ylhepta-1,5-dien-4-imine |
|---|---|
| PubChem CID | 145242402 |
| Molecular Formula | C23H43N |
| Molecular Weight | 333.60 g/mol |
| Exact Mass | 333.34 |
| IUPAC Name | butane;ethane;(3Z,5Z)-3-[1-(1-methylcyclopropyl)propan-2-ylidene]-N-propan-2-ylhepta-1,5-dien-4-imine |
| SMILES | C=CC(=C(C)CC1(C)CC1)C(/C=C\C)=N/C(C)C.CC.CCCC |
| InChI | InChI=1S/C17H27N.C4H10.C2H6/c1-7-9-16(18-13(3)4)15(8-2)14(5)12-17(6)10-11-17;1-3-4-2;1-2/h7-9,13H,2,10-12H2,1,3-6H3;3-4H2,1-2H3;1-2H3/b9-7-,15-14-,18-16+;; |
| InChIKey | YTQVWMOIPSBUCN-OXSYFNGOSA-N |
| XLogP | 7.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.60 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|