C27H30BrN3 — CID 145257750
N-(3-bromobenzenecarboximidoyl)-N-[2,6-di(propan-2-yl)phenyl]-2-methylbenzenecarboximidamide (PubChem CID 145257750) has the molecular formula C27H30BrN3 and a molecular weight of 476.46 g/mol. Its IUPAC name is N-(3-bromobenzenecarboximidoyl)-N-[2,6-di(propan-2-yl)phenyl]-2-methylbenzenecarboximidamide.
| Compound Name | N-(3-bromobenzenecarboximidoyl)-N-[2,6-di(propan-2-yl)phenyl]-2-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 145257750 |
| Molecular Formula | C27H30BrN3 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | N-(3-bromobenzenecarboximidoyl)-N-[2,6-di(propan-2-yl)phenyl]-2-methylbenzenecarboximidamide |
| SMILES | [H]/N=C(\c1cccc(Br)c1)N(/C(=N/[H])c1ccccc1C)c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C27H30BrN3/c1-17(2)22-14-9-15-23(18(3)4)25(22)31(26(29)20-11-8-12-21(28)16-20)27(30)24-13-7-6-10-19(24)5/h6-18,29-30H,1-5H3/b29-26+,30-27+ |
| InChIKey | JUNNWELSYOQTLB-YLTBFOCOSA-N |
| XLogP | 7.86 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|