C28H44FN7O5 — CID 145269848
(2S)-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]-1-[2-[(3-morpholin-4-ylbenzoyl)amino]acetyl]pyrrolidine-2-carboxamide;propane (PubChem CID 145269848) has the molecular formula C28H44FN7O5 and a molecular weight of 577.70 g/mol. Its IUPAC name is (2S)-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]-1-[2-[(3-morpholin-4-ylbenzoyl)amino]acetyl]pyrrolidine-2-carboxamide;propane.
| Compound Name | (2S)-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]-1-[2-[(3-morpholin-4-ylbenzoyl)amino]acetyl]pyrrolidine-2-carboxamide;propane |
|---|---|
| PubChem CID | 145269848 |
| Molecular Formula | C28H44FN7O5 |
| Molecular Weight | 577.70 g/mol |
| Exact Mass | 577.34 |
| IUPAC Name | (2S)-N-[(3S)-6-(diaminomethylideneamino)-1-fluoro-2-oxohexan-3-yl]-1-[2-[(3-morpholin-4-ylbenzoyl)amino]acetyl]pyrrolidine-2-carboxamide;propane |
| SMILES | CCC.NC(N)=NCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)c1cccc(N2CCOCC2)c1)C(=O)CF |
| InChI | InChI=1S/C25H36FN7O5.C3H8/c26-15-21(34)19(6-2-8-29-25(27)28)31-24(37)20-7-3-9-33(20)22(35)16-30-23(36)17-4-1-5-18(14-17)32-10-12-38-13-11-32;1-3-2/h1,4-5,14,19-20H,2-3,6-13,15-16H2,(H,30,36)(H,31,37)(H4,27,28,29);3H2,1-2H3/t19-,20-;/m0./s1 |
| InChIKey | MNXYVUWMCRCLDA-FKLPMGAJSA-N |
| XLogP | 0.74 |
| TPSA | 172.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.70 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|