C37H43F3O4 — CID 145275772
(1E,3E,5Z)-4-[4-[4-[4-(2-hydroxyethoxy)phenyl]-3-methyl-2-(7,7,7-trifluoroheptyl)phenyl]phenyl]-8-methoxyocta-1,3,5-trien-1-ol (PubChem CID 145275772) has the molecular formula C37H43F3O4 and a molecular weight of 608.74 g/mol. Its IUPAC name is (1E,3E,5Z)-4-[4-[4-[4-(2-hydroxyethoxy)phenyl]-3-methyl-2-(7,7,7-trifluoroheptyl)phenyl]phenyl]-8-methoxyocta-1,3,5-trien-1-ol.
| Compound Name | (1E,3E,5Z)-4-[4-[4-[4-(2-hydroxyethoxy)phenyl]-3-methyl-2-(7,7,7-trifluoroheptyl)phenyl]phenyl]-8-methoxyocta-1,3,5-trien-1-ol |
|---|---|
| PubChem CID | 145275772 |
| Molecular Formula | C37H43F3O4 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.31 |
| IUPAC Name | (1E,3E,5Z)-4-[4-[4-[4-(2-hydroxyethoxy)phenyl]-3-methyl-2-(7,7,7-trifluoroheptyl)phenyl]phenyl]-8-methoxyocta-1,3,5-trien-1-ol |
| SMILES | COCC/C=C\C(=C/C=C/O)c1ccc(-c2ccc(-c3ccc(OCCO)cc3)c(C)c2CCCCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C37H43F3O4/c1-28-34(31-17-19-33(20-18-31)44-27-25-42)21-22-36(35(28)12-5-3-4-7-23-37(38,39)40)32-15-13-30(14-16-32)29(11-9-24-41)10-6-8-26-43-2/h6,9-11,13-22,24,41-42H,3-5,7-8,12,23,25-27H2,1-2H3/b10-6-,24-9+,29-11+ |
| InChIKey | JZARXCOPVFOZLN-POODKTNVSA-N |
| XLogP | 9.80 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|