C9H16N2O — CID 145279712
2-[[(3Z)-5-aminohexa-1,3,5-trien-2-yl]-methylamino]ethanol (PubChem CID 145279712) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-[[(3Z)-5-aminohexa-1,3,5-trien-2-yl]-methylamino]ethanol.
| Compound Name | 2-[[(3Z)-5-aminohexa-1,3,5-trien-2-yl]-methylamino]ethanol |
|---|---|
| PubChem CID | 145279712 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 2-[[(3Z)-5-aminohexa-1,3,5-trien-2-yl]-methylamino]ethanol |
| SMILES | C=C(N)/C=C\C(=C)N(C)CCO |
| InChI | InChI=1S/C9H16N2O/c1-8(10)4-5-9(2)11(3)6-7-12/h4-5,12H,1-2,6-7,10H2,3H3/b5-4- |
| InChIKey | QMMBZNJFKHYJIP-PLNGDYQASA-N |
| XLogP | 0.45 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|