C11H11F4N — CID 145285323
1,4,4-trifluoro-2-(4-fluorophenyl)piperidine (PubChem CID 145285323) has the molecular formula C11H11F4N and a molecular weight of 233.21 g/mol. Its IUPAC name is 1,4,4-trifluoro-2-(4-fluorophenyl)piperidine.
| Compound Name | 1,4,4-trifluoro-2-(4-fluorophenyl)piperidine |
|---|---|
| PubChem CID | 145285323 |
| Molecular Formula | C11H11F4N |
| Molecular Weight | 233.21 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 1,4,4-trifluoro-2-(4-fluorophenyl)piperidine |
| SMILES | Fc1ccc(C2CC(F)(F)CCN2F)cc1 |
| InChI | InChI=1S/C11H11F4N/c12-9-3-1-8(2-4-9)10-7-11(13,14)5-6-16(10)15/h1-4,10H,5-7H2 |
| InChIKey | RNIMTWSOLDOHAA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.21 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|