C30H32O3 — CID 14528835
(3Z)-6,8-ditert-butyl-3-[(3-hydroxyphenyl)methylidene]-4-phenyl-4H-chromen-2-one (PubChem CID 14528835) has the molecular formula C30H32O3 and a molecular weight of 440.58 g/mol. Its IUPAC name is (3Z)-6,8-ditert-butyl-3-[(3-hydroxyphenyl)methylidene]-4-phenyl-4H-chromen-2-one.
| Compound Name | (3Z)-6,8-ditert-butyl-3-[(3-hydroxyphenyl)methylidene]-4-phenyl-4H-chromen-2-one |
|---|---|
| PubChem CID | 14528835 |
| Molecular Formula | C30H32O3 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | (3Z)-6,8-ditert-butyl-3-[(3-hydroxyphenyl)methylidene]-4-phenyl-4H-chromen-2-one |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)OC(=O)/C(=C\c1cccc(O)c1)C2c1ccccc1 |
| InChI | InChI=1S/C30H32O3/c1-29(2,3)21-17-23-26(20-12-8-7-9-13-20)24(16-19-11-10-14-22(31)15-19)28(32)33-27(23)25(18-21)30(4,5)6/h7-18,26,31H,1-6H3/b24-16- |
| InChIKey | OJAWFTBYOHRWLW-JLPGSUDCSA-N |
| XLogP | 7.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|