C29H50IN3O2S2 — CID 145294857
azidosulfanylmethane;2-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethoxy thiohypoiodite (PubChem CID 145294857) has the molecular formula C29H50IN3O2S2 and a molecular weight of 663.78 g/mol. Its IUPAC name is azidosulfanylmethane;2-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethoxy thiohypoiodite.
| Compound Name | azidosulfanylmethane;2-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethoxy thiohypoiodite |
|---|---|
| PubChem CID | 145294857 |
| Molecular Formula | C29H50IN3O2S2 |
| Molecular Weight | 663.78 g/mol |
| Exact Mass | 663.24 |
| IUPAC Name | azidosulfanylmethane;2-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethoxy thiohypoiodite |
| SMILES | CC(C)CCCCC1CCC2C3CC=C4CC(OCCOSI)CCC4(C)C3CCC12C.CSN=[N+]=[N-] |
| InChI | InChI=1S/C28H47IO2S.CH3N3S/c1-20(2)7-5-6-8-21-10-12-25-24-11-9-22-19-23(30-17-18-31-32-29)13-15-28(22,4)26(24)14-16-27(21,25)3;1-5-4-3-2/h9,20-21,23-26H,5-8,10-19H2,1-4H3;1H3 |
| InChIKey | UNWVEGZANYCKLH-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.78 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|